C18H22N2O3 — CID 10358275
ethyl (E,4E)-4-(1-methylimidazolidin-2-ylidene)-5-(4-methylphenyl)-5-oxopent-2-enoate (PubChem CID 10358275) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is ethyl (E,4E)-4-(1-methylimidazolidin-2-ylidene)-5-(4-methylphenyl)-5-oxopent-2-enoate.
| Compound Name | ethyl (E,4E)-4-(1-methylimidazolidin-2-ylidene)-5-(4-methylphenyl)-5-oxopent-2-enoate |
|---|---|
| PubChem CID | 10358275 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | ethyl (E,4E)-4-(1-methylimidazolidin-2-ylidene)-5-(4-methylphenyl)-5-oxopent-2-enoate |
| SMILES | CCOC(=O)/C=C/C(C(=O)c1ccc(C)cc1)=C1/NCCN1C |
| InChI | InChI=1S/C18H22N2O3/c1-4-23-16(21)10-9-15(18-19-11-12-20(18)3)17(22)14-7-5-13(2)6-8-14/h5-10,19H,4,11-12H2,1-3H3/b10-9+,18-15+ |
| InChIKey | KNZLYXRYDONRRC-FMAJSODUSA-N |
| XLogP | 2.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|