C14H22N2O2 — CID 172771931
2,4-dimethylbenzoate;1,1-dimethylimidazolidin-1-ium (PubChem CID 172771931) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2,4-dimethylbenzoate;1,1-dimethylimidazolidin-1-ium.
| Compound Name | 2,4-dimethylbenzoate;1,1-dimethylimidazolidin-1-ium |
|---|---|
| PubChem CID | 172771931 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2,4-dimethylbenzoate;1,1-dimethylimidazolidin-1-ium |
| SMILES | C[N+]1(C)CCNC1.Cc1ccc(C(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C9H10O2.C5H13N2/c1-6-3-4-8(9(10)11)7(2)5-6;1-7(2)4-3-6-5-7/h3-5H,1-2H3,(H,10,11);6H,3-5H2,1-2H3/q;+1/p-1 |
| InChIKey | NBODYCAGUAEUIB-UHFFFAOYSA-M |
| XLogP | 0.29 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|