About (2-oxoimidazolidin-1-yl) 2-methylbenzoate
(2-oxoimidazolidin-1-yl) 2-methylbenzoate (PubChem CID 137333513) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is (2-oxoimidazolidin-1-yl) 2-methylbenzoate.
Molecular Properties
| Compound Name | (2-oxoimidazolidin-1-yl) 2-methylbenzoate |
| PubChem CID | 137333513 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (2-oxoimidazolidin-1-yl) 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)ON1CCNC1=O |
| InChI | InChI=1S/C11H12N2O3/c1-8-4-2-3-5-9(8)10(14)16-13-7-6-12-11(13)15/h2-5H,6-7H2,1H3,(H,12,15) |
| InChIKey | PGFVJIOYWKDOJQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-oxoimidazolidin-1-yl) 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxoimidazolidin-1-yl) 2-methylbenzoate?
The IUPAC name of (2-oxoimidazolidin-1-yl) 2-methylbenzoate (CID 137333513) is (2-oxoimidazolidin-1-yl) 2-methylbenzoate.
What is the SMILES notation for (2-oxoimidazolidin-1-yl) 2-methylbenzoate?
The canonical SMILES for (2-oxoimidazolidin-1-yl) 2-methylbenzoate is Cc1ccccc1C(=O)ON1CCNC1=O.
What is the InChIKey of (2-oxoimidazolidin-1-yl) 2-methylbenzoate?
The InChIKey is PGFVJIOYWKDOJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c1-8-4-2-3-5-9(8)10(14)16-13-7-6-12-11(13)15/h2-5H,6-7H2,1H3,(H,12,15).
What are the key properties of (2-oxoimidazolidin-1-yl) 2-methylbenzoate?
(2-oxoimidazolidin-1-yl) 2-methylbenzoate has a molecular weight of 220.23 g/mol, XLogP of 1.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxoimidazolidin-1-yl) 2-methylbenzoate is sourced from PubChem (CID 137333513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).