C10H11N3O2 — CID 11593667
(4,5-dihydro-1H-imidazol-2-ylamino) benzoate (PubChem CID 11593667) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is (4,5-dihydro-1H-imidazol-2-ylamino) benzoate.
| Compound Name | (4,5-dihydro-1H-imidazol-2-ylamino) benzoate |
|---|---|
| PubChem CID | 11593667 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | (4,5-dihydro-1H-imidazol-2-ylamino) benzoate |
| SMILES | O=C(ONC1=NCCN1)c1ccccc1 |
| InChI | InChI=1S/C10H11N3O2/c14-9(8-4-2-1-3-5-8)15-13-10-11-6-7-12-10/h1-5H,6-7H2,(H2,11,12,13) |
| InChIKey | WZIASXFUZUJFQC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|