C10H9Cl2N3O2 — CID 91257729
[(1,4-dichloro-4,5-dihydroimidazol-2-yl)amino] benzoate (PubChem CID 91257729) has the molecular formula C10H9Cl2N3O2 and a molecular weight of 274.11 g/mol. Its IUPAC name is [(1,4-dichloro-4,5-dihydroimidazol-2-yl)amino] benzoate.
| Compound Name | [(1,4-dichloro-4,5-dihydroimidazol-2-yl)amino] benzoate |
|---|---|
| PubChem CID | 91257729 |
| Molecular Formula | C10H9Cl2N3O2 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | [(1,4-dichloro-4,5-dihydroimidazol-2-yl)amino] benzoate |
| SMILES | O=C(ONC1=NC(Cl)CN1Cl)c1ccccc1 |
| InChI | InChI=1S/C10H9Cl2N3O2/c11-8-6-15(12)10(13-8)14-17-9(16)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,13,14) |
| InChIKey | SWROPLFDCXDQRC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|