C11H13N3O3 — CID 139071695
2-amino-3-methyl-1,4-dihydroimidazol-3-ium-5-one benzoate (PubChem CID 139071695) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-amino-3-methyl-1,4-dihydroimidazol-3-ium-5-one benzoate.
| Compound Name | 2-amino-3-methyl-1,4-dihydroimidazol-3-ium-5-one benzoate |
|---|---|
| PubChem CID | 139071695 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-amino-3-methyl-1,4-dihydroimidazol-3-ium-5-one benzoate |
| SMILES | C[N+]1=C(N)NC(=O)C1.O=C([O-])c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C4H7N3O/c8-7(9)6-4-2-1-3-5-6;1-7-2-3(8)6-4(7)5/h1-5H,(H,8,9);2H2,1H3,(H2,5,6,8) |
| InChIKey | GBTJJJUANWCFAS-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|