C13H15N3O3 — CID 139081179
2-amino-3-methyl-1,4-dihydroimidazol-3-ium-5-one;(E)-3-phenylprop-2-enoate (PubChem CID 139081179) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-amino-3-methyl-1,4-dihydroimidazol-3-ium-5-one;(E)-3-phenylprop-2-enoate.
| Compound Name | 2-amino-3-methyl-1,4-dihydroimidazol-3-ium-5-one;(E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 139081179 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-amino-3-methyl-1,4-dihydroimidazol-3-ium-5-one;(E)-3-phenylprop-2-enoate |
| SMILES | C[N+]1=C(N)NC(=O)C1.O=C([O-])/C=C/c1ccccc1 |
| InChI | InChI=1S/C9H8O2.C4H7N3O/c10-9(11)7-6-8-4-2-1-3-5-8;1-7-2-3(8)6-4(7)5/h1-7H,(H,10,11);2H2,1H3,(H2,5,6,8)/b7-6+; |
| InChIKey | UAMBXOPETWTJOK-UHDJGPCESA-N |
| XLogP | -1.48 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|