C14H22N2O2 — CID 67583926
1-ethyl-2,3-dimethylimidazolidin-1-ium benzoate (PubChem CID 67583926) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethylimidazolidin-1-ium benzoate.
| Compound Name | 1-ethyl-2,3-dimethylimidazolidin-1-ium benzoate |
|---|---|
| PubChem CID | 67583926 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-ethyl-2,3-dimethylimidazolidin-1-ium benzoate |
| SMILES | CC[NH+]1CCN(C)C1C.O=C([O-])c1ccccc1 |
| InChI | InChI=1S/C7H16N2.C7H6O2/c1-4-9-6-5-8(3)7(9)2;8-7(9)6-4-2-1-3-5-6/h7H,4-6H2,1-3H3;1-5H,(H,8,9) |
| InChIKey | FHXBTJRNSSGLLR-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 47.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |