About 2-(2-azaniumylethylamino)ethylazanium;phthalate
2-(2-azaniumylethylamino)ethylazanium;phthalate (PubChem CID 74765934) has the molecular formula C12H19N3O4
and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(2-azaniumylethylamino)ethylazanium;phthalate.
Molecular Properties
| Compound Name | 2-(2-azaniumylethylamino)ethylazanium;phthalate |
| PubChem CID | 74765934 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-(2-azaniumylethylamino)ethylazanium;phthalate |
| SMILES | O=C([O-])c1ccccc1C(=O)[O-].[NH3+]CCNCC[NH3+] |
| InChI | InChI=1S/C8H6O4.C4H13N3/c9-7(10)5-3-1-2-4-6(5)8(11)12;5-1-3-7-4-2-6/h1-4H,(H,9,10)(H,11,12);7H,1-6H2 |
| InChIKey | BCNDGYLTSKCASH-UHFFFAOYSA-N |
| XLogP | -4.53 |
| TPSA | 147.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-azaniumylethylamino)ethylazanium;phthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-azaniumylethylamino)ethylazanium;phthalate?
The IUPAC name of 2-(2-azaniumylethylamino)ethylazanium;phthalate (CID 74765934) is 2-(2-azaniumylethylamino)ethylazanium;phthalate.
What is the SMILES notation for 2-(2-azaniumylethylamino)ethylazanium;phthalate?
The canonical SMILES for 2-(2-azaniumylethylamino)ethylazanium;phthalate is O=C([O-])c1ccccc1C(=O)[O-].[NH3+]CCNCC[NH3+].
What is the InChIKey of 2-(2-azaniumylethylamino)ethylazanium;phthalate?
The InChIKey is BCNDGYLTSKCASH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.C4H13N3/c9-7(10)5-3-1-2-4-6(5)8(11)12;5-1-3-7-4-2-6/h1-4H,(H,9,10)(H,11,12);7H,1-6H2.
What are the key properties of 2-(2-azaniumylethylamino)ethylazanium;phthalate?
2-(2-azaniumylethylamino)ethylazanium;phthalate has a molecular weight of 269.30 g/mol, XLogP of -4.53, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-azaniumylethylamino)ethylazanium;phthalate is sourced from PubChem (CID 74765934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).