C20H34N4O4 — CID 69254372
phthalate;bis(1,2,3-trimethylimidazolidin-1-ium) (PubChem CID 69254372) has the molecular formula C20H34N4O4 and a molecular weight of 394.52 g/mol. Its IUPAC name is phthalate;bis(1,2,3-trimethylimidazolidin-1-ium).
| Compound Name | phthalate;bis(1,2,3-trimethylimidazolidin-1-ium) |
|---|---|
| PubChem CID | 69254372 |
| Molecular Formula | C20H34N4O4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | phthalate;bis(1,2,3-trimethylimidazolidin-1-ium) |
| SMILES | CC1N(C)CC[NH+]1C.CC1N(C)CC[NH+]1C.O=C([O-])c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C8H6O4.2C6H14N2/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-6-7(2)4-5-8(6)3/h1-4H,(H,9,10)(H,11,12);2*6H,4-5H2,1-3H3 |
| InChIKey | SVMFHQDZMILFOA-UHFFFAOYSA-N |
| XLogP | -4.00 |
| TPSA | 95.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |