C23H26N2O3 — CID 101175655
ethyl 2-[2-(1,3-diazinan-2-ylidene)-3-(4-methylphenyl)-3-oxopropyl]benzoate (PubChem CID 101175655) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is ethyl 2-[2-(1,3-diazinan-2-ylidene)-3-(4-methylphenyl)-3-oxopropyl]benzoate.
| Compound Name | ethyl 2-[2-(1,3-diazinan-2-ylidene)-3-(4-methylphenyl)-3-oxopropyl]benzoate |
|---|---|
| PubChem CID | 101175655 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | ethyl 2-[2-(1,3-diazinan-2-ylidene)-3-(4-methylphenyl)-3-oxopropyl]benzoate |
| SMILES | CCOC(=O)c1ccccc1CC(C(=O)c1ccc(C)cc1)=C1NCCCN1 |
| InChI | InChI=1S/C23H26N2O3/c1-3-28-23(27)19-8-5-4-7-18(19)15-20(22-24-13-6-14-25-22)21(26)17-11-9-16(2)10-12-17/h4-5,7-12,24-25H,3,6,13-15H2,1-2H3 |
| InChIKey | UDBLSHZVDYAEFR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|