C22H23ClN2O3 — CID 101175654
ethyl 2-[3-(4-chlorophenyl)-2-(1,3-diazinan-2-ylidene)-3-oxopropyl]benzoate (PubChem CID 101175654) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is ethyl 2-[3-(4-chlorophenyl)-2-(1,3-diazinan-2-ylidene)-3-oxopropyl]benzoate.
| Compound Name | ethyl 2-[3-(4-chlorophenyl)-2-(1,3-diazinan-2-ylidene)-3-oxopropyl]benzoate |
|---|---|
| PubChem CID | 101175654 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | ethyl 2-[3-(4-chlorophenyl)-2-(1,3-diazinan-2-ylidene)-3-oxopropyl]benzoate |
| SMILES | CCOC(=O)c1ccccc1CC(C(=O)c1ccc(Cl)cc1)=C1NCCCN1 |
| InChI | InChI=1S/C22H23ClN2O3/c1-2-28-22(27)18-7-4-3-6-16(18)14-19(21-24-12-5-13-25-21)20(26)15-8-10-17(23)11-9-15/h3-4,6-11,24-25H,2,5,12-14H2,1H3 |
| InChIKey | KLLBRGKCFNEGKA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|