C21H32O5 — CID 10546745
methyl (1S,4aS,6aS,8R,10aS,10bR)-8-ethenyl-4,4,6a,8,10b-pentamethyl-3-oxo-4a,5,6,9,10,10a-hexahydro-1H-pyrano[3,4-f]chromene-1-carboxylate (PubChem CID 10546745) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is methyl (1S,4aS,6aS,8R,10aS,10bR)-8-ethenyl-4,4,6a,8,10b-pentamethyl-3-oxo-4a,5,6,9,10,10a-hexahydro-1H-pyrano[3,4-f]chromene-1-carboxylate.
| Compound Name | methyl (1S,4aS,6aS,8R,10aS,10bR)-8-ethenyl-4,4,6a,8,10b-pentamethyl-3-oxo-4a,5,6,9,10,10a-hexahydro-1H-pyrano[3,4-f]chromene-1-carboxylate |
|---|---|
| PubChem CID | 10546745 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | methyl (1S,4aS,6aS,8R,10aS,10bR)-8-ethenyl-4,4,6a,8,10b-pentamethyl-3-oxo-4a,5,6,9,10,10a-hexahydro-1H-pyrano[3,4-f]chromene-1-carboxylate |
| SMILES | C=C[C@@]1(C)CC[C@H]2[C@]3(C)[C@@H](C(=O)OC)OC(=O)C(C)(C)[C@H]3CC[C@]2(C)O1 |
| InChI | InChI=1S/C21H32O5/c1-8-19(4)11-9-14-20(5,26-19)12-10-13-18(2,3)17(23)25-15(16(22)24-7)21(13,14)6/h8,13-15H,1,9-12H2,2-7H3/t13-,14-,15-,19+,20+,21-/m1/s1 |
| InChIKey | ZKQGNVVUMBWBFH-RPRBLNOCSA-N |
| XLogP | 3.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|