C7H12F2O3S — CID 105467498
(3,3-difluoro-4-methyl-1,1-dioxothian-4-yl)methanol (PubChem CID 105467498) has the molecular formula C7H12F2O3S and a molecular weight of 214.23 g/mol. Its IUPAC name is (3,3-difluoro-4-methyl-1,1-dioxothian-4-yl)methanol.
| Compound Name | (3,3-difluoro-4-methyl-1,1-dioxothian-4-yl)methanol |
|---|---|
| PubChem CID | 105467498 |
| Molecular Formula | C7H12F2O3S |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | (3,3-difluoro-4-methyl-1,1-dioxothian-4-yl)methanol |
| SMILES | CC1(CO)CCS(=O)(=O)CC1(F)F |
| InChI | InChI=1S/C7H12F2O3S/c1-6(4-10)2-3-13(11,12)5-7(6,8)9/h10H,2-5H2,1H3 |
| InChIKey | KHABQPBFWRCZJX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |