C14H20N2 — CID 105470484
2-(1-pyrrolidin-3-ylethyl)-1,3-dihydroisoindole (PubChem CID 105470484) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-(1-pyrrolidin-3-ylethyl)-1,3-dihydroisoindole.
| Compound Name | 2-(1-pyrrolidin-3-ylethyl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 105470484 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-(1-pyrrolidin-3-ylethyl)-1,3-dihydroisoindole |
| SMILES | CC(C1CCNC1)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C14H20N2/c1-11(12-6-7-15-8-12)16-9-13-4-2-3-5-14(13)10-16/h2-5,11-12,15H,6-10H2,1H3 |
| InChIKey | BCWUHIGYRVGYDK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |