C13H18N2O2S — CID 65419388
2-pyrrolidin-3-ylsulfonyl-3,4-dihydro-1H-isoquinoline (PubChem CID 65419388) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 2-pyrrolidin-3-ylsulfonyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-pyrrolidin-3-ylsulfonyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 65419388 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-pyrrolidin-3-ylsulfonyl-3,4-dihydro-1H-isoquinoline |
| SMILES | O=S(=O)(C1CCNC1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H18N2O2S/c16-18(17,13-5-7-14-9-13)15-8-6-11-3-1-2-4-12(11)10-15/h1-4,13-14H,5-10H2 |
| InChIKey | PXTQDSPVDVGEPX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |