C17H27N3O2S — CID 119993621
N-piperidin-4-yl-N-propyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide (PubChem CID 119993621) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is N-piperidin-4-yl-N-propyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide.
| Compound Name | N-piperidin-4-yl-N-propyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
|---|---|
| PubChem CID | 119993621 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-piperidin-4-yl-N-propyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
| SMILES | CCCN(C1CCNCC1)S(=O)(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H27N3O2S/c1-2-12-20(17-7-10-18-11-8-17)23(21,22)19-13-9-15-5-3-4-6-16(15)14-19/h3-6,17-18H,2,7-14H2,1H3 |
| InChIKey | LAYVSAFRXLIBJG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |