About 2-(9-azatricyclo[7.2.2.02,7]trideca-2,4,6-trien-1-yl)ethanol
2-(9-azatricyclo[7.2.2.02,7]trideca-2,4,6-trien-1-yl)ethanol (PubChem CID 105471532) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-(9-azatricyclo[7.2.2.02,7]trideca-2,4,6-trien-1-yl)ethanol.
Analyze 2-(9-azatricyclo[7.2.2.02,7]trideca-2,4,6-trien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9-azatricyclo[7.2.2.02,7]trideca-2,4,6-trien-1-yl)ethanol?
The IUPAC name of 2-(9-azatricyclo[7.2.2.02,7]trideca-2,4,6-trien-1-yl)ethanol (CID 105471532) is 2-(9-azatricyclo[7.2.2.02,7]trideca-2,4,6-trien-1-yl)ethanol.
What is the SMILES notation for 2-(9-azatricyclo[7.2.2.02,7]trideca-2,4,6-trien-1-yl)ethanol?
The canonical SMILES for 2-(9-azatricyclo[7.2.2.02,7]trideca-2,4,6-trien-1-yl)ethanol is OCCC12CCN(CC1)Cc1ccccc12.
What is the InChIKey of 2-(9-azatricyclo[7.2.2.02,7]trideca-2,4,6-trien-1-yl)ethanol?
The InChIKey is HORKXOJLRYORRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c16-10-7-14-5-8-15(9-6-14)11-12-3-1-2-4-13(12)14/h1-4,16H,5-11H2.
What are the key properties of 2-(9-azatricyclo[7.2.2.02,7]trideca-2,4,6-trien-1-yl)ethanol?
2-(9-azatricyclo[7.2.2.02,7]trideca-2,4,6-trien-1-yl)ethanol has a molecular weight of 217.31 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9-azatricyclo[7.2.2.02,7]trideca-2,4,6-trien-1-yl)ethanol is sourced from PubChem (CID 105471532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).