About (1S)-1-methyl-9-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene
(1S)-1-methyl-9-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 11095109) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is (1S)-1-methyl-9-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
Analyze (1S)-1-methyl-9-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-methyl-9-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene?
The IUPAC name of (1S)-1-methyl-9-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (CID 11095109) is (1S)-1-methyl-9-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
What is the SMILES notation for (1S)-1-methyl-9-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene?
The canonical SMILES for (1S)-1-methyl-9-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene is C[C@]12CCN(Cc3ccccc31)C2.
What is the InChIKey of (1S)-1-methyl-9-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene?
The InChIKey is UAACPUBIHDCLIQ-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H15N/c1-12-6-7-13(9-12)8-10-4-2-3-5-11(10)12/h2-5H,6-9H2,1H3/t12-/m1/s1.
What are the key properties of (1S)-1-methyl-9-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene?
(1S)-1-methyl-9-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene has a molecular weight of 173.26 g/mol, XLogP of 2.16, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-methyl-9-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene is sourced from PubChem (CID 11095109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).