C17H17N5O3S — CID 10547195
4-(benzimidazol-1-yl)-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide (PubChem CID 10547195) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide.
| Compound Name | 4-(benzimidazol-1-yl)-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 10547195 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-(benzimidazol-1-yl)-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide |
| SMILES | Cc1cc(-n2cnc3ccccc32)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C17H17N5O3S/c1-10-7-14(22-9-20-12-5-3-4-6-13(12)22)15(26(2,24)25)8-11(10)16(23)21-17(18)19/h3-9H,1-2H3,(H4,18,19,21,23) |
| InChIKey | OJSNDNLRRPOXDM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|