C25H25N3O3S — CID 56671942
1-[(2-methylsulfonylphenyl)methyl]-N-[(1R)-1-phenylpropyl]benzimidazole-5-carboxamide (PubChem CID 56671942) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is 1-[(2-methylsulfonylphenyl)methyl]-N-[(1R)-1-phenylpropyl]benzimidazole-5-carboxamide.
| Compound Name | 1-[(2-methylsulfonylphenyl)methyl]-N-[(1R)-1-phenylpropyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 56671942 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 1-[(2-methylsulfonylphenyl)methyl]-N-[(1R)-1-phenylpropyl]benzimidazole-5-carboxamide |
| SMILES | CC[C@@H](NC(=O)c1ccc2c(c1)ncn2Cc1ccccc1S(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C25H25N3O3S/c1-3-21(18-9-5-4-6-10-18)27-25(29)19-13-14-23-22(15-19)26-17-28(23)16-20-11-7-8-12-24(20)32(2,30)31/h4-15,17,21H,3,16H2,1-2H3,(H,27,29)/t21-/m1/s1 |
| InChIKey | BVHNFKVNSHVVDH-OAQYLSRUSA-N |
| XLogP | 4.37 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |