C13H18N2O — CID 105472938
3-[(cyclopropylamino)methyl]-1,2,3,4-tetrahydroisoquinolin-8-ol (PubChem CID 105472938) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-[(cyclopropylamino)methyl]-1,2,3,4-tetrahydroisoquinolin-8-ol.
| Compound Name | 3-[(cyclopropylamino)methyl]-1,2,3,4-tetrahydroisoquinolin-8-ol |
|---|---|
| PubChem CID | 105472938 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 3-[(cyclopropylamino)methyl]-1,2,3,4-tetrahydroisoquinolin-8-ol |
| SMILES | Oc1cccc2c1CNC(CNC1CC1)C2 |
| InChI | InChI=1S/C13H18N2O/c16-13-3-1-2-9-6-11(15-8-12(9)13)7-14-10-4-5-10/h1-3,10-11,14-16H,4-8H2 |
| InChIKey | WZHZJFHDRUOSOI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|