About 5-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid
5-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid (PubChem CID 105473568) has the molecular formula C12H10FNO2
and a molecular weight of 219.22 g/mol. Its IUPAC name is 5-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid.
Analyze 5-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid?
The IUPAC name of 5-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid (CID 105473568) is 5-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid.
What is the SMILES notation for 5-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid?
The canonical SMILES for 5-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid is O=C(O)C1Cc2cc3c(F)cccc3n2C1.
What is the InChIKey of 5-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid?
The InChIKey is JDPSKFJIYIYFED-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FNO2/c13-10-2-1-3-11-9(10)5-8-4-7(12(15)16)6-14(8)11/h1-3,5,7H,4,6H2,(H,15,16).
What are the key properties of 5-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid?
5-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid has a molecular weight of 219.22 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid is sourced from PubChem (CID 105473568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).