C15H15FN2O2 — CID 71563709
1-(8-fluoroquinolin-4-yl)piperidine-4-carboxylic acid (PubChem CID 71563709) has the molecular formula C15H15FN2O2 and a molecular weight of 274.29 g/mol. Its IUPAC name is 1-(8-fluoroquinolin-4-yl)piperidine-4-carboxylic acid.
| Compound Name | 1-(8-fluoroquinolin-4-yl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 71563709 |
| Molecular Formula | C15H15FN2O2 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-(8-fluoroquinolin-4-yl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2ccnc3c(F)cccc23)CC1 |
| InChI | InChI=1S/C15H15FN2O2/c16-12-3-1-2-11-13(4-7-17-14(11)12)18-8-5-10(6-9-18)15(19)20/h1-4,7,10H,5-6,8-9H2,(H,19,20) |
| InChIKey | OFXWRBXSYRABGA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |