1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid

C13H13FN2O3 — CID 122047375

IUPAC1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid
SMILESO=C(O)C1CCN(c2nc3c(F)cccc3o2)CC1
InChIInChI=1S/C13H13FN2O3/c14-9-2-1-3-10-11(9)15-13(19-10)16-6-4-8(5-7-16)12(17)18/h1-3,8H,4-7H2,(H,17,18)
InChIKeyVUQFQCIEDVNGBX-UHFFFAOYSA-N
MW264.26 g/mol
LogP2.27
Rot. Bonds2

About 1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid

1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid (PubChem CID 122047375) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is 1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid.

Molecular Properties

Compound Name1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid
PubChem CID122047375
Molecular FormulaC13H13FN2O3
Molecular Weight264.26 g/mol
Exact Mass264.09
IUPAC Name1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid
SMILESO=C(O)C1CCN(c2nc3c(F)cccc3o2)CC1
InChIInChI=1S/C13H13FN2O3/c14-9-2-1-3-10-11(9)15-13(19-10)16-6-4-8(5-7-16)12(17)18/h1-3,8H,4-7H2,(H,17,18)
InChIKeyVUQFQCIEDVNGBX-UHFFFAOYSA-N
XLogP2.27
TPSA66.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.26
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid?
The IUPAC name of 1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid (CID 122047375) is 1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid.
What is the SMILES notation for 1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid?
The canonical SMILES for 1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid is O=C(O)C1CCN(c2nc3c(F)cccc3o2)CC1.
What is the InChIKey of 1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid?
The InChIKey is VUQFQCIEDVNGBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FN2O3/c14-9-2-1-3-10-11(9)15-13(19-10)16-6-4-8(5-7-16)12(17)18/h1-3,8H,4-7H2,(H,17,18).
What are the key properties of 1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid?
1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid has a molecular weight of 264.26 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid is sourced from PubChem (CID 122047375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).