C13H13FN2O3 — CID 122047375
1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid (PubChem CID 122047375) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is 1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid.
| Compound Name | 1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 122047375 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 1-(4-fluoro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2nc3c(F)cccc3o2)CC1 |
| InChI | InChI=1S/C13H13FN2O3/c14-9-2-1-3-10-11(9)15-13(19-10)16-6-4-8(5-7-16)12(17)18/h1-3,8H,4-7H2,(H,17,18) |
| InChIKey | VUQFQCIEDVNGBX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |