About (3-fluorophenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate
(3-fluorophenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate (PubChem CID 16590590) has the molecular formula C19H17FN2O3
and a molecular weight of 340.35 g/mol. Its IUPAC name is (3-fluorophenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | (3-fluorophenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate |
| PubChem CID | 16590590 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (3-fluorophenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate |
| SMILES | O=C(Oc1cccc(F)c1)C1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C19H17FN2O3/c20-14-4-3-5-15(12-14)24-18(23)13-8-10-22(11-9-13)19-21-16-6-1-2-7-17(16)25-19/h1-7,12-13H,8-11H2 |
| InChIKey | KOBZESCVQSLYJH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-fluorophenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorophenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
The IUPAC name of (3-fluorophenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate (CID 16590590) is (3-fluorophenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate.
What is the SMILES notation for (3-fluorophenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
The canonical SMILES for (3-fluorophenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate is O=C(Oc1cccc(F)c1)C1CCN(c2nc3ccccc3o2)CC1.
What is the InChIKey of (3-fluorophenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
The InChIKey is KOBZESCVQSLYJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN2O3/c20-14-4-3-5-15(12-14)24-18(23)13-8-10-22(11-9-13)19-21-16-6-1-2-7-17(16)25-19/h1-7,12-13H,8-11H2.
What are the key properties of (3-fluorophenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
(3-fluorophenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate has a molecular weight of 340.35 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl) 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate is sourced from PubChem (CID 16590590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).