C17H22N2O4 — CID 60562732
3-methoxypropyl 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate (PubChem CID 60562732) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-methoxypropyl 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate.
| Compound Name | 3-methoxypropyl 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 60562732 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3-methoxypropyl 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate |
| SMILES | COCCCOC(=O)C1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C17H22N2O4/c1-21-11-4-12-22-16(20)13-7-9-19(10-8-13)17-18-14-5-2-3-6-15(14)23-17/h2-3,5-6,13H,4,7-12H2,1H3 |
| InChIKey | AIHVWOFFBVOLOG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|