1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid

C17H20N2O4 — CID 155125461

IUPAC1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid
SMILESCOc1cc2nccc(N3CCC(C(=O)O)CC3)c2cc1OC
InChIInChI=1S/C17H20N2O4/c1-22-15-9-12-13(10-16(15)23-2)18-6-3-14(12)19-7-4-11(5-8-19)17(20)21/h3,6,9-11H,4-5,7-8H2,1-2H3,(H,20,21)
InChIKeyVHDFHTLSHGEVSQ-UHFFFAOYSA-N
MW316.36 g/mol
LogP2.55
Rot. Bonds4

About 1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid

1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid (PubChem CID 155125461) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid.

Molecular Properties

Compound Name1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid
PubChem CID155125461
Molecular FormulaC17H20N2O4
Molecular Weight316.36 g/mol
Exact Mass316.14
IUPAC Name1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid
SMILESCOc1cc2nccc(N3CCC(C(=O)O)CC3)c2cc1OC
InChIInChI=1S/C17H20N2O4/c1-22-15-9-12-13(10-16(15)23-2)18-6-3-14(12)19-7-4-11(5-8-19)17(20)21/h3,6,9-11H,4-5,7-8H2,1-2H3,(H,20,21)
InChIKeyVHDFHTLSHGEVSQ-UHFFFAOYSA-N
XLogP2.55
TPSA71.89 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.36
LogP ≤ 52.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid?
The IUPAC name of 1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid (CID 155125461) is 1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid.
What is the SMILES notation for 1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid?
The canonical SMILES for 1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid is COc1cc2nccc(N3CCC(C(=O)O)CC3)c2cc1OC.
What is the InChIKey of 1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid?
The InChIKey is VHDFHTLSHGEVSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O4/c1-22-15-9-12-13(10-16(15)23-2)18-6-3-14(12)19-7-4-11(5-8-19)17(20)21/h3,6,9-11H,4-5,7-8H2,1-2H3,(H,20,21).
What are the key properties of 1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid?
1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid has a molecular weight of 316.36 g/mol, XLogP of 2.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid is sourced from PubChem (CID 155125461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).