C17H20N2O4 — CID 155125461
1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid (PubChem CID 155125461) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid.
| Compound Name | 1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 155125461 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-(6,7-dimethoxyquinolin-4-yl)piperidine-4-carboxylic acid |
| SMILES | COc1cc2nccc(N3CCC(C(=O)O)CC3)c2cc1OC |
| InChI | InChI=1S/C17H20N2O4/c1-22-15-9-12-13(10-16(15)23-2)18-6-3-14(12)19-7-4-11(5-8-19)17(20)21/h3,6,9-11H,4-5,7-8H2,1-2H3,(H,20,21) |
| InChIKey | VHDFHTLSHGEVSQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |