About 1-[[(3R)-1-(6,7-dimethoxyquinolin-4-yl)piperidin-3-yl]methyl]piperidin-2-one
1-[[(3R)-1-(6,7-dimethoxyquinolin-4-yl)piperidin-3-yl]methyl]piperidin-2-one (PubChem CID 70313258) has the molecular formula C22H29N3O3
and a molecular weight of 383.49 g/mol. Its IUPAC name is 1-[[(3R)-1-(6,7-dimethoxyquinolin-4-yl)piperidin-3-yl]methyl]piperidin-2-one.
Molecular Properties
| Compound Name | 1-[[(3R)-1-(6,7-dimethoxyquinolin-4-yl)piperidin-3-yl]methyl]piperidin-2-one |
| PubChem CID | 70313258 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 1-[[(3R)-1-(6,7-dimethoxyquinolin-4-yl)piperidin-3-yl]methyl]piperidin-2-one |
| SMILES | COc1cc2nccc(N3CCC[C@@H](CN4CCCCC4=O)C3)c2cc1OC |
| InChI | InChI=1S/C22H29N3O3/c1-27-20-12-17-18(13-21(20)28-2)23-9-8-19(17)24-11-5-6-16(14-24)15-25-10-4-3-7-22(25)26/h8-9,12-13,16H,3-7,10-11,14-15H2,1-2H3/t16-/m1/s1 |
| InChIKey | JZCPUZVMIMUCAT-MRXNPFEDSA-N |
| XLogP | 3.48 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[(3R)-1-(6,7-dimethoxyquinolin-4-yl)piperidin-3-yl]methyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(3R)-1-(6,7-dimethoxyquinolin-4-yl)piperidin-3-yl]methyl]piperidin-2-one?
The IUPAC name of 1-[[(3R)-1-(6,7-dimethoxyquinolin-4-yl)piperidin-3-yl]methyl]piperidin-2-one (CID 70313258) is 1-[[(3R)-1-(6,7-dimethoxyquinolin-4-yl)piperidin-3-yl]methyl]piperidin-2-one.
What is the SMILES notation for 1-[[(3R)-1-(6,7-dimethoxyquinolin-4-yl)piperidin-3-yl]methyl]piperidin-2-one?
The canonical SMILES for 1-[[(3R)-1-(6,7-dimethoxyquinolin-4-yl)piperidin-3-yl]methyl]piperidin-2-one is COc1cc2nccc(N3CCC[C@@H](CN4CCCCC4=O)C3)c2cc1OC.
What is the InChIKey of 1-[[(3R)-1-(6,7-dimethoxyquinolin-4-yl)piperidin-3-yl]methyl]piperidin-2-one?
The InChIKey is JZCPUZVMIMUCAT-MRXNPFEDSA-N. The full InChI is InChI=1S/C22H29N3O3/c1-27-20-12-17-18(13-21(20)28-2)23-9-8-19(17)24-11-5-6-16(14-24)15-25-10-4-3-7-22(25)26/h8-9,12-13,16H,3-7,10-11,14-15H2,1-2H3/t16-/m1/s1.
What are the key properties of 1-[[(3R)-1-(6,7-dimethoxyquinolin-4-yl)piperidin-3-yl]methyl]piperidin-2-one?
1-[[(3R)-1-(6,7-dimethoxyquinolin-4-yl)piperidin-3-yl]methyl]piperidin-2-one has a molecular weight of 383.49 g/mol, XLogP of 3.48, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(3R)-1-(6,7-dimethoxyquinolin-4-yl)piperidin-3-yl]methyl]piperidin-2-one is sourced from PubChem (CID 70313258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).