C21H30N4O6S — CID 175688776
butyl N-[[1-(6,7-dimethoxyquinolin-4-yl)piperidin-4-yl]sulfamoyl]carbamate (PubChem CID 175688776) has the molecular formula C21H30N4O6S and a molecular weight of 466.56 g/mol. Its IUPAC name is butyl N-[[1-(6,7-dimethoxyquinolin-4-yl)piperidin-4-yl]sulfamoyl]carbamate.
| Compound Name | butyl N-[[1-(6,7-dimethoxyquinolin-4-yl)piperidin-4-yl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 175688776 |
| Molecular Formula | C21H30N4O6S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | butyl N-[[1-(6,7-dimethoxyquinolin-4-yl)piperidin-4-yl]sulfamoyl]carbamate |
| SMILES | CCCCOC(=O)NS(=O)(=O)NC1CCN(c2ccnc3cc(OC)c(OC)cc23)CC1 |
| InChI | InChI=1S/C21H30N4O6S/c1-4-5-12-31-21(26)24-32(27,28)23-15-7-10-25(11-8-15)18-6-9-22-17-14-20(30-3)19(29-2)13-16(17)18/h6,9,13-15,23H,4-5,7-8,10-12H2,1-3H3,(H,24,26) |
| InChIKey | XLSKEIHHXFFEHL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|