C22H31N4O4S- — CID 155618180
4-[4-[1-(2-cyclopropyl-2-sulfinatohydrazinyl)propan-2-yl]piperidin-1-yl]-6,7-dimethoxyquinoline (PubChem CID 155618180) has the molecular formula C22H31N4O4S- and a molecular weight of 447.58 g/mol. Its IUPAC name is 4-[4-[1-(2-cyclopropyl-2-sulfinatohydrazinyl)propan-2-yl]piperidin-1-yl]-6,7-dimethoxyquinoline.
| Compound Name | 4-[4-[1-(2-cyclopropyl-2-sulfinatohydrazinyl)propan-2-yl]piperidin-1-yl]-6,7-dimethoxyquinoline |
|---|---|
| PubChem CID | 155618180 |
| Molecular Formula | C22H31N4O4S- |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 4-[4-[1-(2-cyclopropyl-2-sulfinatohydrazinyl)propan-2-yl]piperidin-1-yl]-6,7-dimethoxyquinoline |
| SMILES | COc1cc2nccc(N3CCC(C(C)CNN(C4CC4)S(=O)[O-])CC3)c2cc1OC |
| InChI | InChI=1S/C22H32N4O4S/c1-15(14-24-26(31(27)28)17-4-5-17)16-7-10-25(11-8-16)20-6-9-23-19-13-22(30-3)21(29-2)12-18(19)20/h6,9,12-13,15-17,24H,4-5,7-8,10-11,14H2,1-3H3,(H,27,28)/p-1 |
| InChIKey | NYKXUSLFSQRBBV-UHFFFAOYSA-M |
| XLogP | 2.87 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|