C22H32N4O2S — CID 155697816
S-[cyclopropyl-[2-[1-(6,7-dimethoxyquinolin-4-yl)piperidin-4-yl]propyl]amino]thiohydroxylamine (PubChem CID 155697816) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is S-[cyclopropyl-[2-[1-(6,7-dimethoxyquinolin-4-yl)piperidin-4-yl]propyl]amino]thiohydroxylamine.
| Compound Name | S-[cyclopropyl-[2-[1-(6,7-dimethoxyquinolin-4-yl)piperidin-4-yl]propyl]amino]thiohydroxylamine |
|---|---|
| PubChem CID | 155697816 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | S-[cyclopropyl-[2-[1-(6,7-dimethoxyquinolin-4-yl)piperidin-4-yl]propyl]amino]thiohydroxylamine |
| SMILES | COc1cc2nccc(N3CCC(C(C)CN(SN)C4CC4)CC3)c2cc1OC |
| InChI | InChI=1S/C22H32N4O2S/c1-15(14-26(29-23)17-4-5-17)16-7-10-25(11-8-16)20-6-9-24-19-13-22(28-3)21(27-2)12-18(19)20/h6,9,12-13,15-17H,4-5,7-8,10-11,14,23H2,1-3H3 |
| InChIKey | WZNQKKVANCGIQY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|