C23H34N4O5S — CID 175192711
tert-butyl N-[2-[1-(7-methoxyquinolin-4-yl)piperidin-4-yl]propyl]-N-sulfamoylcarbamate (PubChem CID 175192711) has the molecular formula C23H34N4O5S and a molecular weight of 478.62 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(7-methoxyquinolin-4-yl)piperidin-4-yl]propyl]-N-sulfamoylcarbamate.
| Compound Name | tert-butyl N-[2-[1-(7-methoxyquinolin-4-yl)piperidin-4-yl]propyl]-N-sulfamoylcarbamate |
|---|---|
| PubChem CID | 175192711 |
| Molecular Formula | C23H34N4O5S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | tert-butyl N-[2-[1-(7-methoxyquinolin-4-yl)piperidin-4-yl]propyl]-N-sulfamoylcarbamate |
| SMILES | COc1ccc2c(N3CCC(C(C)CN(C(=O)OC(C)(C)C)S(N)(=O)=O)CC3)ccnc2c1 |
| InChI | InChI=1S/C23H34N4O5S/c1-16(15-27(33(24,29)30)22(28)32-23(2,3)4)17-9-12-26(13-10-17)21-8-11-25-20-14-18(31-5)6-7-19(20)21/h6-8,11,14,16-17H,9-10,12-13,15H2,1-5H3,(H2,24,29,30) |
| InChIKey | UDWHNTVHCOXPLA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |