C23H34N4O6S — CID 175192737
4-[4-[1-[cyclopropyl(sulfamoyl)amino]propan-2-yl]piperidin-1-yl]-6,7-dimethoxyquinoline;formic acid (PubChem CID 175192737) has the molecular formula C23H34N4O6S and a molecular weight of 494.61 g/mol. Its IUPAC name is 4-[4-[1-[cyclopropyl(sulfamoyl)amino]propan-2-yl]piperidin-1-yl]-6,7-dimethoxyquinoline;formic acid.
| Compound Name | 4-[4-[1-[cyclopropyl(sulfamoyl)amino]propan-2-yl]piperidin-1-yl]-6,7-dimethoxyquinoline;formic acid |
|---|---|
| PubChem CID | 175192737 |
| Molecular Formula | C23H34N4O6S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 4-[4-[1-[cyclopropyl(sulfamoyl)amino]propan-2-yl]piperidin-1-yl]-6,7-dimethoxyquinoline;formic acid |
| SMILES | COc1cc2nccc(N3CCC(C(C)CN(C4CC4)S(N)(=O)=O)CC3)c2cc1OC.O=CO |
| InChI | InChI=1S/C22H32N4O4S.CH2O2/c1-15(14-26(17-4-5-17)31(23,27)28)16-7-10-25(11-8-16)20-6-9-24-19-13-22(30-3)21(29-2)12-18(19)20;2-1-3/h6,9,12-13,15-17H,4-5,7-8,10-11,14H2,1-3H3,(H2,23,27,28);1H,(H,2,3) |
| InChIKey | GXRSDEKOAULFSZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|