C30H48N4O7S — CID 155618198
tert-butyl N-tert-butyl-N-[2-[1-[7-methoxy-6-(2-methoxyethoxy)quinolin-4-yl]piperidin-4-yl]propylsulfamoyl]carbamate (PubChem CID 155618198) has the molecular formula C30H48N4O7S and a molecular weight of 608.80 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[2-[1-[7-methoxy-6-(2-methoxyethoxy)quinolin-4-yl]piperidin-4-yl]propylsulfamoyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[2-[1-[7-methoxy-6-(2-methoxyethoxy)quinolin-4-yl]piperidin-4-yl]propylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 155618198 |
| Molecular Formula | C30H48N4O7S |
| Molecular Weight | 608.80 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[2-[1-[7-methoxy-6-(2-methoxyethoxy)quinolin-4-yl]piperidin-4-yl]propylsulfamoyl]carbamate |
| SMILES | COCCOc1cc2c(N3CCC(C(C)CNS(=O)(=O)N(C(=O)OC(C)(C)C)C(C)(C)C)CC3)ccnc2cc1OC |
| InChI | InChI=1S/C30H48N4O7S/c1-21(20-32-42(36,37)34(29(2,3)4)28(35)41-30(5,6)7)22-11-14-33(15-12-22)25-10-13-31-24-19-26(39-9)27(18-23(24)25)40-17-16-38-8/h10,13,18-19,21-22,32H,11-12,14-17,20H2,1-9H3 |
| InChIKey | ZMBQRDFOXGMDRJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.80 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|