C19H27N5O6S — CID 155125446
2-[4-(6,7-dimethoxyquinolin-4-yl)piperazin-1-yl]propylsulfamoylcarbamic acid (PubChem CID 155125446) has the molecular formula C19H27N5O6S and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-[4-(6,7-dimethoxyquinolin-4-yl)piperazin-1-yl]propylsulfamoylcarbamic acid.
| Compound Name | 2-[4-(6,7-dimethoxyquinolin-4-yl)piperazin-1-yl]propylsulfamoylcarbamic acid |
|---|---|
| PubChem CID | 155125446 |
| Molecular Formula | C19H27N5O6S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 2-[4-(6,7-dimethoxyquinolin-4-yl)piperazin-1-yl]propylsulfamoylcarbamic acid |
| SMILES | COc1cc2nccc(N3CCN(C(C)CNS(=O)(=O)NC(=O)O)CC3)c2cc1OC |
| InChI | InChI=1S/C19H27N5O6S/c1-13(12-21-31(27,28)22-19(25)26)23-6-8-24(9-7-23)16-4-5-20-15-11-18(30-3)17(29-2)10-14(15)16/h4-5,10-11,13,21-22H,6-9,12H2,1-3H3,(H,25,26) |
| InChIKey | RAJRIZQMAGQVLU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 133.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |