C20H27FN4O2S — CID 155697828
S-[[1-[1-[6-(fluoromethoxy)-7-methoxyquinolin-4-yl]piperidin-4-yl]cyclopropyl]methylamino]thiohydroxylamine (PubChem CID 155697828) has the molecular formula C20H27FN4O2S and a molecular weight of 406.53 g/mol. Its IUPAC name is S-[[1-[1-[6-(fluoromethoxy)-7-methoxyquinolin-4-yl]piperidin-4-yl]cyclopropyl]methylamino]thiohydroxylamine.
| Compound Name | S-[[1-[1-[6-(fluoromethoxy)-7-methoxyquinolin-4-yl]piperidin-4-yl]cyclopropyl]methylamino]thiohydroxylamine |
|---|---|
| PubChem CID | 155697828 |
| Molecular Formula | C20H27FN4O2S |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | S-[[1-[1-[6-(fluoromethoxy)-7-methoxyquinolin-4-yl]piperidin-4-yl]cyclopropyl]methylamino]thiohydroxylamine |
| SMILES | COc1cc2nccc(N3CCC(C4(CNSN)CC4)CC3)c2cc1OCF |
| InChI | InChI=1S/C20H27FN4O2S/c1-26-18-11-16-15(10-19(18)27-13-21)17(2-7-23-16)25-8-3-14(4-9-25)20(5-6-20)12-24-28-22/h2,7,10-11,14,24H,3-6,8-9,12-13,22H2,1H3 |
| InChIKey | KPRLEUOJJFDKLB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 72.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|