C19H27N6O5S- — CID 175190160
4-[4-[1-[carbamoyl-(sulfinatoamino)amino]propan-2-yl]piperidin-1-yl]-6,7-dimethoxyquinazoline (PubChem CID 175190160) has the molecular formula C19H27N6O5S- and a molecular weight of 451.53 g/mol. Its IUPAC name is 4-[4-[1-[carbamoyl-(sulfinatoamino)amino]propan-2-yl]piperidin-1-yl]-6,7-dimethoxyquinazoline.
| Compound Name | 4-[4-[1-[carbamoyl-(sulfinatoamino)amino]propan-2-yl]piperidin-1-yl]-6,7-dimethoxyquinazoline |
|---|---|
| PubChem CID | 175190160 |
| Molecular Formula | C19H27N6O5S- |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 4-[4-[1-[carbamoyl-(sulfinatoamino)amino]propan-2-yl]piperidin-1-yl]-6,7-dimethoxyquinazoline |
| SMILES | COc1cc2ncnc(N3CCC(C(C)CN(NS(=O)[O-])C(N)=O)CC3)c2cc1OC |
| InChI | InChI=1S/C19H28N6O5S/c1-12(10-25(19(20)26)23-31(27)28)13-4-6-24(7-5-13)18-14-8-16(29-2)17(30-3)9-15(14)21-11-22-18/h8-9,11-13,23H,4-7,10H2,1-3H3,(H2,20,26)(H,27,28)/p-1 |
| InChIKey | SYHXRQUBVOHXPC-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 145.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|