C13H17FN2 — CID 105475984
6-fluoro-3-piperidin-4-yl-2,3-dihydro-1H-indole (PubChem CID 105475984) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 6-fluoro-3-piperidin-4-yl-2,3-dihydro-1H-indole.
| Compound Name | 6-fluoro-3-piperidin-4-yl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 105475984 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 6-fluoro-3-piperidin-4-yl-2,3-dihydro-1H-indole |
| SMILES | Fc1ccc2c(c1)NCC2C1CCNCC1 |
| InChI | InChI=1S/C13H17FN2/c14-10-1-2-11-12(8-16-13(11)7-10)9-3-5-15-6-4-9/h1-2,7,9,12,15-16H,3-6,8H2 |
| InChIKey | PJTWRFOKXFFBJG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |