C16H23FN2S — CID 144855096
[4-(6-fluoro-2,3-dihydro-1H-indol-3-yl)piperidin-1-yl]-methyl-dimethylidene-λ6-sulfane (PubChem CID 144855096) has the molecular formula C16H23FN2S and a molecular weight of 294.44 g/mol. Its IUPAC name is [4-(6-fluoro-2,3-dihydro-1H-indol-3-yl)piperidin-1-yl]-methyl-dimethylidene-λ6-sulfane.
| Compound Name | [4-(6-fluoro-2,3-dihydro-1H-indol-3-yl)piperidin-1-yl]-methyl-dimethylidene-λ6-sulfane |
|---|---|
| PubChem CID | 144855096 |
| Molecular Formula | C16H23FN2S |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | [4-(6-fluoro-2,3-dihydro-1H-indol-3-yl)piperidin-1-yl]-methyl-dimethylidene-λ6-sulfane |
| SMILES | C=S(=C)(C)N1CCC(C2CNc3cc(F)ccc32)CC1 |
| InChI | InChI=1S/C16H23FN2S/c1-20(2,3)19-8-6-12(7-9-19)15-11-18-16-10-13(17)4-5-14(15)16/h4-5,10,12,15,18H,1-2,6-9,11H2,3H3 |
| InChIKey | ZPMCHVIVKMIQLD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|