C13H17FN2 — CID 105476002
(3-fluoro-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-7-yl)methanamine (PubChem CID 105476002) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is (3-fluoro-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-7-yl)methanamine.
| Compound Name | (3-fluoro-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-7-yl)methanamine |
|---|---|
| PubChem CID | 105476002 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | (3-fluoro-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-7-yl)methanamine |
| SMILES | NCC1CCC2Cc3ccc(F)cc3N2C1 |
| InChI | InChI=1S/C13H17FN2/c14-11-3-2-10-5-12-4-1-9(7-15)8-16(12)13(10)6-11/h2-3,6,9,12H,1,4-5,7-8,15H2 |
| InChIKey | BOFLXUZUPAJDQU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |