C7H8F3N3O2 — CID 105480219
5-amino-4-ethyl-1-(trifluoromethyl)pyrazole-3-carboxylic acid (PubChem CID 105480219) has the molecular formula C7H8F3N3O2 and a molecular weight of 223.15 g/mol. Its IUPAC name is 5-amino-4-ethyl-1-(trifluoromethyl)pyrazole-3-carboxylic acid.
| Compound Name | 5-amino-4-ethyl-1-(trifluoromethyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 105480219 |
| Molecular Formula | C7H8F3N3O2 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 5-amino-4-ethyl-1-(trifluoromethyl)pyrazole-3-carboxylic acid |
| SMILES | CCc1c(C(=O)O)nn(C(F)(F)F)c1N |
| InChI | InChI=1S/C7H8F3N3O2/c1-2-3-4(6(14)15)12-13(5(3)11)7(8,9)10/h2,11H2,1H3,(H,14,15) |
| InChIKey | XGVVUYPCPXXZHX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |