C8H13N3O2 — CID 21432458
5-amino-1,4-diethylpyrazole-3-carboxylic acid (PubChem CID 21432458) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-amino-1,4-diethylpyrazole-3-carboxylic acid.
| Compound Name | 5-amino-1,4-diethylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 21432458 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 5-amino-1,4-diethylpyrazole-3-carboxylic acid |
| SMILES | CCc1c(C(=O)O)nn(CC)c1N |
| InChI | InChI=1S/C8H13N3O2/c1-3-5-6(8(12)13)10-11(4-2)7(5)9/h3-4,9H2,1-2H3,(H,12,13) |
| InChIKey | RRBRDBRZGATFRW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |