2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid

C10H13N3O3 — CID 105480301

IUPAC2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid
SMILESO=C(O)Cc1nncc(C2CCCCO2)n1
InChIInChI=1S/C10H13N3O3/c14-10(15)5-9-12-7(6-11-13-9)8-3-1-2-4-16-8/h6,8H,1-5H2,(H,14,15)
InChIKeyZPLTUUCLQTZDAI-UHFFFAOYSA-N
MW223.23 g/mol
LogP0.74
Rot. Bonds3

About 2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid

2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid (PubChem CID 105480301) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid
PubChem CID105480301
Molecular FormulaC10H13N3O3
Molecular Weight223.23 g/mol
Exact Mass223.10
IUPAC Name2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid
SMILESO=C(O)Cc1nncc(C2CCCCO2)n1
InChIInChI=1S/C10H13N3O3/c14-10(15)5-9-12-7(6-11-13-9)8-3-1-2-4-16-8/h6,8H,1-5H2,(H,14,15)
InChIKeyZPLTUUCLQTZDAI-UHFFFAOYSA-N
XLogP0.74
TPSA85.20 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.23
LogP ≤ 50.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid?
The IUPAC name of 2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid (CID 105480301) is 2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid.
What is the SMILES notation for 2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid?
The canonical SMILES for 2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid is O=C(O)Cc1nncc(C2CCCCO2)n1.
What is the InChIKey of 2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid?
The InChIKey is ZPLTUUCLQTZDAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O3/c14-10(15)5-9-12-7(6-11-13-9)8-3-1-2-4-16-8/h6,8H,1-5H2,(H,14,15).
What are the key properties of 2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid?
2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid has a molecular weight of 223.23 g/mol, XLogP of 0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(oxan-2-yl)-1,2,4-triazin-3-yl]acetic acid is sourced from PubChem (CID 105480301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).