C10H12N2O2 — CID 135030167
6-[(2R)-oxolan-2-yl]pyridine-3-carboxamide (PubChem CID 135030167) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 6-[(2R)-oxolan-2-yl]pyridine-3-carboxamide.
| Compound Name | 6-[(2R)-oxolan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135030167 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 6-[(2R)-oxolan-2-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc([C@H]2CCCO2)nc1 |
| InChI | InChI=1S/C10H12N2O2/c11-10(13)7-3-4-8(12-6-7)9-2-1-5-14-9/h3-4,6,9H,1-2,5H2,(H2,11,13)/t9-/m1/s1 |
| InChIKey | DOWRBDQJJNJJNP-SECBINFHSA-N |
| XLogP | 1.03 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |