C14H15N5O2 — CID 110269000
6-(4-pyrimidin-2-ylmorpholin-2-yl)pyridine-3-carboxamide (PubChem CID 110269000) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 6-(4-pyrimidin-2-ylmorpholin-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-(4-pyrimidin-2-ylmorpholin-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110269000 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 6-(4-pyrimidin-2-ylmorpholin-2-yl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(C2CN(c3ncccn3)CCO2)nc1 |
| InChI | InChI=1S/C14H15N5O2/c15-13(20)10-2-3-11(18-8-10)12-9-19(6-7-21-12)14-16-4-1-5-17-14/h1-5,8,12H,6-7,9H2,(H2,15,20) |
| InChIKey | ULRHECZOGDJJIC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |