C16H21N3O4 — CID 95847907
6-[(2S)-4-(oxane-4-carbonyl)morpholin-2-yl]pyridine-3-carboxamide (PubChem CID 95847907) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 6-[(2S)-4-(oxane-4-carbonyl)morpholin-2-yl]pyridine-3-carboxamide.
| Compound Name | 6-[(2S)-4-(oxane-4-carbonyl)morpholin-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95847907 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 6-[(2S)-4-(oxane-4-carbonyl)morpholin-2-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc([C@@H]2CN(C(=O)C3CCOCC3)CCO2)nc1 |
| InChI | InChI=1S/C16H21N3O4/c17-15(20)12-1-2-13(18-9-12)14-10-19(5-8-23-14)16(21)11-3-6-22-7-4-11/h1-2,9,11,14H,3-8,10H2,(H2,17,20)/t14-/m0/s1 |
| InChIKey | OGFQEBYLOHTVII-AWEZNQCLSA-N |
| XLogP | 0.51 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |