C9H17FO3S — CID 105482103
4-(1,1-dioxothian-3-yl)-3-fluorobutan-2-ol (PubChem CID 105482103) has the molecular formula C9H17FO3S and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-(1,1-dioxothian-3-yl)-3-fluorobutan-2-ol.
| Compound Name | 4-(1,1-dioxothian-3-yl)-3-fluorobutan-2-ol |
|---|---|
| PubChem CID | 105482103 |
| Molecular Formula | C9H17FO3S |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 4-(1,1-dioxothian-3-yl)-3-fluorobutan-2-ol |
| SMILES | CC(O)C(F)CC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17FO3S/c1-7(11)9(10)5-8-3-2-4-14(12,13)6-8/h7-9,11H,2-6H2,1H3 |
| InChIKey | JAWYTTCMMVNUJK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |