C19H21BrN2S — CID 10548368
1-(4-bromo-3,3-dimethylbutyl)-2-phenylsulfanylbenzimidazole (PubChem CID 10548368) has the molecular formula C19H21BrN2S and a molecular weight of 389.36 g/mol. Its IUPAC name is 1-(4-bromo-3,3-dimethylbutyl)-2-phenylsulfanylbenzimidazole.
| Compound Name | 1-(4-bromo-3,3-dimethylbutyl)-2-phenylsulfanylbenzimidazole |
|---|---|
| PubChem CID | 10548368 |
| Molecular Formula | C19H21BrN2S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 1-(4-bromo-3,3-dimethylbutyl)-2-phenylsulfanylbenzimidazole |
| SMILES | CC(C)(CBr)CCn1c(Sc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C19H21BrN2S/c1-19(2,14-20)12-13-22-17-11-7-6-10-16(17)21-18(22)23-15-8-4-3-5-9-15/h3-11H,12-14H2,1-2H3 |
| InChIKey | ALDOMCMYVPXRBC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|