C23H20N2O2SSe — CID 102184589
4-[1-(3-phenylselanylpropyl)benzimidazol-2-yl]sulfanylbenzoic acid (PubChem CID 102184589) has the molecular formula C23H20N2O2SSe and a molecular weight of 467.45 g/mol. Its IUPAC name is 4-[1-(3-phenylselanylpropyl)benzimidazol-2-yl]sulfanylbenzoic acid.
| Compound Name | 4-[1-(3-phenylselanylpropyl)benzimidazol-2-yl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 102184589 |
| Molecular Formula | C23H20N2O2SSe |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | 4-[1-(3-phenylselanylpropyl)benzimidazol-2-yl]sulfanylbenzoic acid |
| SMILES | O=C(O)c1ccc(Sc2nc3ccccc3n2CCC[Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O2SSe/c26-22(27)17-11-13-18(14-12-17)28-23-24-20-9-4-5-10-21(20)25(23)15-6-16-29-19-7-2-1-3-8-19/h1-5,7-14H,6,15-16H2,(H,26,27) |
| InChIKey | XJPYEXFULCVVDU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|